C2H5NH2 , C6H5NHCH3, (C2H5)2NH and C6H5NH2 

For the above compounds, decreasing order of the pKb values (in gaseous phase) is -

1. C6H5NHC6H5NHCHC2H5NH2(C2H5)2NH

2. C2H5NH2 C6H5NHCHC6H5NH2 > (C2H5)2NH

3. C6H5NHCH3 C6H5NH2 C2H5NH2(C2H5)2NH

4. (C2H5)2NH C6H5NHCHC2H5NH2C6H5NH2

Subtopic:  Amines - Preparation & Properties |
 66%
Level 2: 60%+
Hints

The increasing order of boiling point among the given compounds is:

C2H5OH, (CH3)2NH, and C2H5NH2

1. (CH3)2NH < C2H5NH< C2H5OH

2. (CH3)2NH > C2H5NH2 > C2H5OH

3. (CH3)2NH < C2H5OH < C2H5NH

4. (CH3)2NH > C2H5OH > C2H5NH2

Subtopic:  Amines - Preparation & Properties |
 77%
Level 2: 60%+
Hints

The increasing sequence of solubility of the following molecules in water is: 
C6H5NH2, (C2H5)2NH, C2H5NH 

1. C6H5NH2 < (C2H5)2NH < C2H5NH2

2. C6H5NH2 > (C2H5)2NH < C2H5NH2

3. C6H5NH2 > (C2H5)2NH > C2H5NH2

4. C6H5NH2 < (C2H5)2NH > C2H5NH2

Subtopic:  Amines - Preparation & Properties |
 55%
Level 3: 35%-60%
Hints

advertisementadvertisement

Amines are less acidic than alcohols of comparable molecular masses because :

1. N is more electronegative than O.

2. O is more electronegative than N.

3. N can accomodate negative charge easily than O

4. Amides are more stable than alcohols

Subtopic:  Amines - Preparation & Properties |
 83%
Level 1: 80%+
Hints

Aromatic primary amines cannot be prepared by Gabriel phthalimide synthesis because :

1. Alkyl halides do not undergo electrophilic substitution with the anion formed by the phthalimide
2. Alkyl halides do not undergo nucleophilic substitution with the anion formed by the phthalimide
3. Aryl halides do not undergo nucleophilic substitution with the anion formed by the phthalimide
4. Aryl halides do not undergo electrophilic substitution with the anion formed by the phthalimide

Subtopic:  Amines - Preparation & Properties |
 73%
Level 2: 60%+
Hints

 Predict the product formed when benzenediazonium chloride reacts with hypophosphorous acid and water.

C₆H₅N₂Cl + H₃PO₂ + H₂O → Product

1. C₆H₅NC
2. C₆H₅CH₃
3. C₆H₅CN
4. C₆H₆
Subtopic:  Amines - Preparation & Properties |
 84%
Level 1: 80%+
Hints

advertisementadvertisement

   

X, Y, and Z in the above sequence are:

1. X= Fe/HCl, Y= Br2/FeCl3, and Z = H2O/ warm

2. X= Br2/FeCl3, Y= Fe/HCl, and Z = H2O/ warm

3.  X= HBr/hv, Y= Fe/HCl, and Z = H3PO2

4. X = HBr/hv Y = Br2/FeCl3, and Z = H3PO2

Subtopic:  Amines - Preparation & Properties |
 87%
Level 1: 80%+
Hints

Benzyl chloride KCN X LiAlH4 Y

The product X and Y are -

1. 2-Phenylethanenitrile and Benzoic acid

2. Benzonitrile and Benzoic acid

3. 2-Phenylethanenitrile and 2-Phenylethanamine

4. Benzonitrile and 2-Phenylethanamine

Subtopic:  Amines - Preparation & Properties |
 58%
Level 3: 35%-60%
Hints

The formula of A and B in the following reaction is -

C6H5N2ClCuCNC6H5CNH2O/H+ANH3,B
1. C6H5COOH,andC6H5CONH2
2. C6H5COOH,andC6H5NH2
3. C6H5CH2NH2,andC6H5CH2N=NH
4. C6H5CH2NH2,andC6H5CH2N=NH

Subtopic:  Amines - Preparation & Properties |
 77%
Level 2: 60%+
Hints

advertisementadvertisement

Consider the following statements related to ammonolysis.

a. Cleavage of C-X bond by ammonia takes place.
b. Ammonolysis produces primary, secondary, tertiary amine and quaternary ammonium salt.
c. In ammonolysis, ammonia is a nucleophile.


The true statement(s) are:
1. a, b
2. a, b, c
3. a, c
4. b

Subtopic:  Amines - Preparation & Properties |
 84%
Level 1: 80%+
Hints