The major product of the following reaction is:

1. a hemiacetal                 

2. an acetal

3. an ether                       

4. an ester

 

निम्नलिखित अभिक्रिया का प्रमुख उत्पाद है:

Anhydous- निर्जल

(1) एक हेमीएसीटेल                        
(2) एक एसीटेल
(3) एक ईथर                               
(4) एक एस्टर

 

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Succinic acid (A)NH3(B)KOHBr2(C); Product (C) will be:

1. CH2|-CO2HCH2-CH2-NH2

2. CH2|-CO2HCH2-NH2

3. CH2|-CO-2K+CH2-NH2

4. CH2|-CO2HCH2-CH2-Br

 

सक्सिनिक अम्ल (A)NH3(B)KOHBr2(C); उत्पाद (C) होगा:

1. CH2|-CO2HCH2-CH2-NH2

2. CH2|-CO2HCH2-NH2

3. CH2|-CO-2K+CH2-NH2

4. CH2|-CO2HCH2-CH2-Br

 

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

R-CH2-CH2OH can be converted into RCH2CH3COOH. The correct sequence of reagents is: 

1. PBr3, KCN, H

2. PBr3, KCN, H2     

3. KCN, H+

4. HCN, PBr3, H+

R-CH2-CH2OH को RCH2CH3COOH में रूपांतरित किया जा सकता है। अभिकर्मकों का सही अनुक्रम है:

1. PBr3, KCN, H

2. PBr3, KCN, H2     

3. KCN, H+

4. HCN, PBr3, H+

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

The reaction 

can be classified as

1. Alcohol formation reaction

2. Dehydration reaction

3. Williamson alcohol synthesis reaction

4. Williamson ether synthesis reaction

अभिक्रिया

को किस रूप में वर्गीकृत किया जा सकता है?

1. एल्कोहॉल निर्माण अभिक्रिया

2. निर्जलीकरण अभिक्रिया

3. विलियमसन एल्कोहॉल संश्लेषण अभिक्रिया

4. विलियमसन ईथर संश्लेषण अभिक्रिया

Level 4: Below 35%

To unlock all the explanations of this course, you need to be enrolled.

Hints

(CH3)3C-O-CH3 + HI Products, the product are

1. (CH3)3C-OH + CH3l

2. (CH3)3C-l + CH3OH

3. (CH3)3C-l + CH3l

4. (CH3)3C-OH + CH3OH

(CH3)3C-O-CH3 + HI उत्पाद, उत्पाद हैं:

1. (CH3)3C-OH + CH3l

2. (CH3)3C-l + CH3OH

3. (CH3)3C-l + CH3l

4. (CH3)3C-OH + CH3OH

Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

The main product of the following reaction is:

C6H5CH2CH(OH)CH(CH3)2Conc.H2SO4?

(1) 

(2) 

(3) 

(4)  

निम्नलिखित अभिक्रिया का मुख्य उत्पाद है:

C6H5CH2CH(OH)CH(CH3)2Conc.H2SO4?

(1) 

(2) 

(3) 

(4)  

 67%
Level 2: 60%+

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

Which of the following compounds are not oxidized by HIO4?

1. 5,6,7     

2. 4,5,6,7     

3. 6,7     

4. 3,4,5,6,7

निम्नलिखित में से कौन सा यौगिक HIO4 द्वारा ऑक्सीकृत नहीं होता है?

1. 5,6,7     

2. 4,5,6,7     

3. 6,7     

4. 3,4,5,6,7

 57%
Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

Phenol is less soluble in water. It is due to:

1. non-polar nature of phenol

2. acidic nature of -OH group

3. non-polar hydrocarbon part in it

4. none of the above

फीनॉल जल में अल्प विलेय है। यह निम्न कारण से होता है-

1. फीनॉल की अध्रुवीय प्रकृति

2. -OH समूह की अम्लीय प्रकृति

3. इसमें अध्रुवीय हाइड्रोकार्बन भाग

4. उपरोक्त में से कोई नहीं

 56%
Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints

When phenol is treated with excess bromine water, it gives:

1. m-bromophenol

2. o- and p-bromophenol

3. 2,4-dibromophenol

4. 2,4,6-tribromophenol

जब फीनॉल को आधिक्य ब्रोमीन जल के साथ उपचारित किया जाता है, तो यह देता है:
1. m-ब्रोमोफीनॉल

2. o- और p-ब्रोमोफीनॉल

3. 2,4-डाइब्रोमोफीनॉल

4. 2,4,6-ट्राइब्रोमोफीनॉल

 60%
Level 2: 60%+

To unlock all the explanations of this course, you need to be enrolled.

Hints

advertisementadvertisement

How many isomers of C5H11OH will be primary alcohols?

1. 5

2. 4

3. 2

4. 3

C5H11OH के कितने समावयवीं प्राथमिक एल्कोहॉल होंगे?

1. 5

2. 4

3. 2

4. 3

Level 3: 35%-60%

To unlock all the explanations of this course, you need to be enrolled.

Hints